C21H27IO2Si — CID 132565889
(3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-(3-iodopropyl)-2,3,3a,4-tetrahydro-1-benzofuran-5-one (PubChem CID 132565889) has the molecular formula C21H27IO2Si and a molecular weight of 466.44 g/mol. Its IUPAC name is (3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-(3-iodopropyl)-2,3,3a,4-tetrahydro-1-benzofuran-5-one.
| Compound Name | (3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-(3-iodopropyl)-2,3,3a,4-tetrahydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 132565889 |
| Molecular Formula | C21H27IO2Si |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | (3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-(3-iodopropyl)-2,3,3a,4-tetrahydro-1-benzofuran-5-one |
| SMILES | C=C([C@@H]1CO[C@]2(CCCI)C=CC(=O)C[C@H]12)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H27IO2Si/c1-16(25(2,3)18-8-5-4-6-9-18)19-15-24-21(11-7-13-22)12-10-17(23)14-20(19)21/h4-6,8-10,12,19-20H,1,7,11,13-15H2,2-3H3/t19-,20+,21+/m0/s1 |
| InChIKey | CORNPNQZMJYHBV-PWRODBHTSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|