C20H26O2Si — CID 132565896
(3R,3aR,7aS)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-methoxy-2,3,3a,4-tetrahydro-1H-inden-5-one (PubChem CID 132565896) has the molecular formula C20H26O2Si and a molecular weight of 326.51 g/mol. Its IUPAC name is (3R,3aR,7aS)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-methoxy-2,3,3a,4-tetrahydro-1H-inden-5-one.
| Compound Name | (3R,3aR,7aS)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-methoxy-2,3,3a,4-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 132565896 |
| Molecular Formula | C20H26O2Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (3R,3aR,7aS)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-methoxy-2,3,3a,4-tetrahydro-1H-inden-5-one |
| SMILES | C=C([C@@H]1CC[C@]2(OC)C=CC(=O)C[C@H]12)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H26O2Si/c1-15(23(3,4)17-8-6-5-7-9-17)18-11-13-20(22-2)12-10-16(21)14-19(18)20/h5-10,12,18-19H,1,11,13-14H2,2-4H3/t18-,19+,20+/m0/s1 |
| InChIKey | YKBRFVLZGBLGPP-XUVXKRRUSA-N |
| XLogP | 3.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|