C21H28O2Si — CID 132565897
(3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-propan-2-yl-2,3,3a,4-tetrahydro-1-benzofuran-5-one (PubChem CID 132565897) has the molecular formula C21H28O2Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-propan-2-yl-2,3,3a,4-tetrahydro-1-benzofuran-5-one.
| Compound Name | (3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-propan-2-yl-2,3,3a,4-tetrahydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 132565897 |
| Molecular Formula | C21H28O2Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3S,3aR,7aR)-3-[1-[dimethyl(phenyl)silyl]ethenyl]-7a-propan-2-yl-2,3,3a,4-tetrahydro-1-benzofuran-5-one |
| SMILES | C=C([C@@H]1CO[C@]2(C(C)C)C=CC(=O)C[C@H]12)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H28O2Si/c1-15(2)21-12-11-17(22)13-20(21)19(14-23-21)16(3)24(4,5)18-9-7-6-8-10-18/h6-12,15,19-20H,3,13-14H2,1-2,4-5H3/t19-,20+,21-/m0/s1 |
| InChIKey | HTGDCOHQLAVYTE-HBMCJLEFSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|