About 3-phenylbenzo[f][1,2]benzothiazole
3-phenylbenzo[f][1,2]benzothiazole (PubChem CID 132566230) has the molecular formula C17H11NS
and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-phenylbenzo[f][1,2]benzothiazole.
Molecular Properties
| Compound Name | 3-phenylbenzo[f][1,2]benzothiazole |
| PubChem CID | 132566230 |
| Molecular Formula | C17H11NS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3-phenylbenzo[f][1,2]benzothiazole |
| SMILES | c1ccc(-c2nsc3cc4ccccc4cc23)cc1 |
| InChI | InChI=1S/C17H11NS/c1-2-6-12(7-3-1)17-15-10-13-8-4-5-9-14(13)11-16(15)19-18-17/h1-11H |
| InChIKey | VRNWDVNGMVNISX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenylbenzo[f][1,2]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbenzo[f][1,2]benzothiazole?
The IUPAC name of 3-phenylbenzo[f][1,2]benzothiazole (CID 132566230) is 3-phenylbenzo[f][1,2]benzothiazole.
What is the SMILES notation for 3-phenylbenzo[f][1,2]benzothiazole?
The canonical SMILES for 3-phenylbenzo[f][1,2]benzothiazole is c1ccc(-c2nsc3cc4ccccc4cc23)cc1.
What is the InChIKey of 3-phenylbenzo[f][1,2]benzothiazole?
The InChIKey is VRNWDVNGMVNISX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NS/c1-2-6-12(7-3-1)17-15-10-13-8-4-5-9-14(13)11-16(15)19-18-17/h1-11H.
What are the key properties of 3-phenylbenzo[f][1,2]benzothiazole?
3-phenylbenzo[f][1,2]benzothiazole has a molecular weight of 261.35 g/mol, XLogP of 5.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbenzo[f][1,2]benzothiazole is sourced from PubChem (CID 132566230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).