C19H23FO8 — CID 132566969
[(2R,3R,4S,5S,6R)-2,3-diacetyloxy-5-fluoro-6-(phenylmethoxymethyl)oxan-4-yl] acetate (PubChem CID 132566969) has the molecular formula C19H23FO8 and a molecular weight of 398.38 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-2,3-diacetyloxy-5-fluoro-6-(phenylmethoxymethyl)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-2,3-diacetyloxy-5-fluoro-6-(phenylmethoxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 132566969 |
| Molecular Formula | C19H23FO8 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-2,3-diacetyloxy-5-fluoro-6-(phenylmethoxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H](COCc2ccccc2)[C@H](F)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H23FO8/c1-11(21)25-17-16(20)15(10-24-9-14-7-5-4-6-8-14)28-19(27-13(3)23)18(17)26-12(2)22/h4-8,15-19H,9-10H2,1-3H3/t15-,16+,17-,18-,19+/m1/s1 |
| InChIKey | DHLTZSVBLZRKEM-ZRSRNVLSSA-N |
| XLogP | 1.69 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|