C25H14F6N4O6 — CID 132567219
2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propan-2-yl]phenoxy]-5-nitropyridine (PubChem CID 132567219) has the molecular formula C25H14F6N4O6 and a molecular weight of 580.40 g/mol. Its IUPAC name is 2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propan-2-yl]phenoxy]-5-nitropyridine.
| Compound Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propan-2-yl]phenoxy]-5-nitropyridine |
|---|---|
| PubChem CID | 132567219 |
| Molecular Formula | C25H14F6N4O6 |
| Molecular Weight | 580.40 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]propan-2-yl]phenoxy]-5-nitropyridine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(C(c3ccc(Oc4ccc([N+](=O)[O-])cn4)cc3)(C(F)(F)F)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C25H14F6N4O6/c26-24(27,28)23(25(29,30)31,15-1-7-19(8-2-15)40-21-11-5-17(13-32-21)34(36)37)16-3-9-20(10-4-16)41-22-12-6-18(14-33-22)35(38)39/h1-14H |
| InChIKey | KFNBAYSRMFZXBP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 130.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.40 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|