C6H6Cl2N2O2 — CID 132567564
4,5-dichloro-1,3-dimethylimidazol-1-ium-2-carboxylate (PubChem CID 132567564) has the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. Its IUPAC name is 4,5-dichloro-1,3-dimethylimidazol-1-ium-2-carboxylate.
| Compound Name | 4,5-dichloro-1,3-dimethylimidazol-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 132567564 |
| Molecular Formula | C6H6Cl2N2O2 |
| Molecular Weight | 209.03 g/mol |
| Exact Mass | 207.98 |
| IUPAC Name | 4,5-dichloro-1,3-dimethylimidazol-1-ium-2-carboxylate |
| SMILES | Cn1c(Cl)c(Cl)[n+](C)c1C(=O)[O-] |
| InChI | InChI=1S/C6H6Cl2N2O2/c1-9-3(7)4(8)10(2)5(9)6(11)12/h1-2H3 |
| InChIKey | NELBUDMHGHACIJ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.03 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|