About 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole
3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole (PubChem CID 132567623) has the molecular formula C29H21NO
and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole.
Molecular Properties
| Compound Name | 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole |
| PubChem CID | 132567623 |
| Molecular Formula | C29H21NO |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole |
| SMILES | COc1ccc2c3c(c(-c4ccccc4)c(-c4ccccc4)c2c1)C1=CC=CCC1=N3 |
| InChI | InChI=1S/C29H21NO/c1-31-21-16-17-22-24(18-21)26(19-10-4-2-5-11-19)27(20-12-6-3-7-13-20)28-23-14-8-9-15-25(23)30-29(22)28/h2-14,16-18H,15H2,1H3 |
| InChIKey | INVWEZOLWONCRN-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole?
The IUPAC name of 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole (CID 132567623) is 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole.
What is the SMILES notation for 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole?
The canonical SMILES for 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole is COc1ccc2c3c(c(-c4ccccc4)c(-c4ccccc4)c2c1)C1=CC=CCC1=N3.
What is the InChIKey of 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole?
The InChIKey is INVWEZOLWONCRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H21NO/c1-31-21-16-17-22-24(18-21)26(19-10-4-2-5-11-19)27(20-12-6-3-7-13-20)28-23-14-8-9-15-25(23)30-29(22)28/h2-14,16-18H,15H2,1H3.
What are the key properties of 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole?
3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole has a molecular weight of 399.49 g/mol, XLogP of 7.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5,6-diphenyl-10H-benzo[a]carbazole is sourced from PubChem (CID 132567623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).