About (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol
(3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 132567869) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol.
Molecular Properties
| Compound Name | (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol |
| PubChem CID | 132567869 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCO[C@@H]1C=C[C@@H](O)CO1 |
| InChI | InChI=1S/C7H12O3/c1-2-9-7-4-3-6(8)5-10-7/h3-4,6-8H,2,5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | HFFPGANQUSYUNI-RQJHMYQMSA-N |
| XLogP | 0.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol?
The IUPAC name of (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol (CID 132567869) is (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol.
What is the SMILES notation for (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol?
The canonical SMILES for (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol is CCO[C@@H]1C=C[C@@H](O)CO1.
What is the InChIKey of (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol?
The InChIKey is HFFPGANQUSYUNI-RQJHMYQMSA-N. The full InChI is InChI=1S/C7H12O3/c1-2-9-7-4-3-6(8)5-10-7/h3-4,6-8H,2,5H2,1H3/t6-,7+/m1/s1.
What are the key properties of (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol?
(3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol has a molecular weight of 144.17 g/mol, XLogP of 0.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6S)-6-ethoxy-3,6-dihydro-2H-pyran-3-ol is sourced from PubChem (CID 132567869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).