C28H31N3O7 — CID 132568045
[(2R,3S,6S)-3-acetyloxy-6-[2-[4-(benzhydryloxymethyl)triazol-1-yl]ethoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 132568045) has the molecular formula C28H31N3O7 and a molecular weight of 521.57 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[2-[4-(benzhydryloxymethyl)triazol-1-yl]ethoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[2-[4-(benzhydryloxymethyl)triazol-1-yl]ethoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 132568045 |
| Molecular Formula | C28H31N3O7 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[2-[4-(benzhydryloxymethyl)triazol-1-yl]ethoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OCCn2cc(COC(c3ccccc3)c3ccccc3)nn2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H31N3O7/c1-20(32)35-19-26-25(37-21(2)33)13-14-27(38-26)34-16-15-31-17-24(29-30-31)18-36-28(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-14,17,25-28H,15-16,18-19H2,1-2H3/t25-,26+,27-/m0/s1 |
| InChIKey | GLSNPBXYVNDYDF-VJGNERBWSA-N |
| XLogP | 3.38 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|