C16H18N2Se2 — CID 132568370
2,5-dibutyl-7,8-diselenabicyclo[4.2.0]octa-1(6),2,4-triene-3,4-dicarbonitrile (PubChem CID 132568370) has the molecular formula C16H18N2Se2 and a molecular weight of 396.25 g/mol. Its IUPAC name is 2,5-dibutyl-7,8-diselenabicyclo[4.2.0]octa-1(6),2,4-triene-3,4-dicarbonitrile.
| Compound Name | 2,5-dibutyl-7,8-diselenabicyclo[4.2.0]octa-1(6),2,4-triene-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 132568370 |
| Molecular Formula | C16H18N2Se2 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 2,5-dibutyl-7,8-diselenabicyclo[4.2.0]octa-1(6),2,4-triene-3,4-dicarbonitrile |
| SMILES | CCCCc1c(C#N)c(C#N)c(CCCC)c2[se][se]c12 |
| InChI | InChI=1S/C16H18N2Se2/c1-3-5-7-11-13(9-17)14(10-18)12(8-6-4-2)16-15(11)19-20-16/h3-8H2,1-2H3 |
| InChIKey | ZYEOPMGYCDYZLW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|