About [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane
[2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane (PubChem CID 132568411) has the molecular formula C20H24FNO2SSi
and a molecular weight of 389.57 g/mol. Its IUPAC name is [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane.
Molecular Properties
| Compound Name | [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane |
| PubChem CID | 132568411 |
| Molecular Formula | C20H24FNO2SSi |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2c(F)c([Si](C)(C)C)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C20H24FNO2SSi/c1-13-11-14(2)18(15(3)12-13)25(23,24)22-17-10-8-7-9-16(17)19(20(22)21)26(4,5)6/h7-12H,1-6H3 |
| InChIKey | KFMHFXAEOOEFKU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane?
The IUPAC name of [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane (CID 132568411) is [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane.
What is the SMILES notation for [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane?
The canonical SMILES for [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane is Cc1cc(C)c(S(=O)(=O)n2c(F)c([Si](C)(C)C)c3ccccc32)c(C)c1.
What is the InChIKey of [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane?
The InChIKey is KFMHFXAEOOEFKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24FNO2SSi/c1-13-11-14(2)18(15(3)12-13)25(23,24)22-17-10-8-7-9-16(17)19(20(22)21)26(4,5)6/h7-12H,1-6H3.
What are the key properties of [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane?
[2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane has a molecular weight of 389.57 g/mol, XLogP of 4.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]-trimethylsilane is sourced from PubChem (CID 132568411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).