About [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene
[(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene (PubChem CID 132568471) has the molecular formula C12H14F3NO2S
and a molecular weight of 293.31 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene.
Molecular Properties
| Compound Name | [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene |
| PubChem CID | 132568471 |
| Molecular Formula | C12H14F3NO2S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene |
| SMILES | CCCS[C@@](C[N+](=O)[O-])(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO2S/c1-2-8-19-11(9-16(17)18,12(13,14)15)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | MOEBTQYKJOTRMM-NSHDSACASA-N |
| XLogP | 3.86 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene?
The IUPAC name of [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene (CID 132568471) is [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene.
What is the SMILES notation for [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene?
The canonical SMILES for [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene is CCCS[C@@](C[N+](=O)[O-])(c1ccccc1)C(F)(F)F.
What is the InChIKey of [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene?
The InChIKey is MOEBTQYKJOTRMM-NSHDSACASA-N. The full InChI is InChI=1S/C12H14F3NO2S/c1-2-8-19-11(9-16(17)18,12(13,14)15)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3/t11-/m0/s1.
What are the key properties of [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene?
[(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene has a molecular weight of 293.31 g/mol, XLogP of 3.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1,1,1-trifluoro-3-nitro-2-propylsulfanylpropan-2-yl]benzene is sourced from PubChem (CID 132568471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).