C36H33ClNO6P — CID 132568659
ethyl (1S,4R,5R)-5-(4-chlorophenyl)-3-[2-ethoxy-2-oxo-1-(triphenyl-λ5-phosphanylidene)ethyl]-4-nitrocyclopent-2-ene-1-carboxylate (PubChem CID 132568659) has the molecular formula C36H33ClNO6P and a molecular weight of 642.09 g/mol. Its IUPAC name is ethyl (1S,4R,5R)-5-(4-chlorophenyl)-3-[2-ethoxy-2-oxo-1-(triphenyl-λ5-phosphanylidene)ethyl]-4-nitrocyclopent-2-ene-1-carboxylate.
| Compound Name | ethyl (1S,4R,5R)-5-(4-chlorophenyl)-3-[2-ethoxy-2-oxo-1-(triphenyl-λ5-phosphanylidene)ethyl]-4-nitrocyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 132568659 |
| Molecular Formula | C36H33ClNO6P |
| Molecular Weight | 642.09 g/mol |
| Exact Mass | 641.17 |
| IUPAC Name | ethyl (1S,4R,5R)-5-(4-chlorophenyl)-3-[2-ethoxy-2-oxo-1-(triphenyl-λ5-phosphanylidene)ethyl]-4-nitrocyclopent-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C(C1=C[C@H](C(=O)OCC)[C@H](c2ccc(Cl)cc2)[C@H]1[N+](=O)[O-])=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H33ClNO6P/c1-3-43-35(39)30-24-31(33(38(41)42)32(30)25-20-22-26(37)23-21-25)34(36(40)44-4-2)45(27-14-8-5-9-15-27,28-16-10-6-11-17-28)29-18-12-7-13-19-29/h5-24,30,32-33H,3-4H2,1-2H3/t30-,32-,33-/m0/s1 |
| InChIKey | BMJZKDVZPWYUIO-RGRQWMLTSA-N |
| XLogP | 5.92 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.09 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|