C23H21BrN2O — CID 132568726
(2E,4E)-5-(4-bromophenyl)-6-oxo-6-phenyl-3-piperidin-1-ylhexa-2,4-dienenitrile (PubChem CID 132568726) has the molecular formula C23H21BrN2O and a molecular weight of 421.34 g/mol. Its IUPAC name is (2E,4E)-5-(4-bromophenyl)-6-oxo-6-phenyl-3-piperidin-1-ylhexa-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-(4-bromophenyl)-6-oxo-6-phenyl-3-piperidin-1-ylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 132568726 |
| Molecular Formula | C23H21BrN2O |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (2E,4E)-5-(4-bromophenyl)-6-oxo-6-phenyl-3-piperidin-1-ylhexa-2,4-dienenitrile |
| SMILES | N#C/C=C(\C=C(\C(=O)c1ccccc1)c1ccc(Br)cc1)N1CCCCC1 |
| InChI | InChI=1S/C23H21BrN2O/c24-20-11-9-18(10-12-20)22(23(27)19-7-3-1-4-8-19)17-21(13-14-25)26-15-5-2-6-16-26/h1,3-4,7-13,17H,2,5-6,15-16H2/b21-13+,22-17+ |
| InChIKey | GBKSDHZIPWCCGT-BRAPJGFWSA-N |
| XLogP | 5.61 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|