About CID 132569192
CID 132569192 (PubChem CID 132569192) has the molecular formula C5H9O5
and a molecular weight of 149.12 g/mol.
Molecular Properties
| Compound Name | CID 132569192 |
| PubChem CID | 132569192 |
| Molecular Formula | C5H9O5 |
| Molecular Weight | 149.12 g/mol |
| Exact Mass | 149.04 |
| IUPAC Name | — |
| SMILES | CCC(CC(=O)O[O])OO |
| InChI | InChI=1S/C5H9O5/c1-2-4(9-7)3-5(6)10-8/h4,7H,2-3H2,1H3 |
| InChIKey | WNMYQXAKCDRYTL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.12 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 132569192 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 132569192?
The IUPAC name of CID 132569192 (CID 132569192) is not available.
What is the SMILES notation for CID 132569192?
The canonical SMILES for CID 132569192 is CCC(CC(=O)O[O])OO.
What is the InChIKey of CID 132569192?
The InChIKey is WNMYQXAKCDRYTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O5/c1-2-4(9-7)3-5(6)10-8/h4,7H,2-3H2,1H3.
What are the key properties of CID 132569192?
CID 132569192 has a molecular weight of 149.12 g/mol, XLogP of 0.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 132569192 is sourced from PubChem (CID 132569192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).