About (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate
(3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate (PubChem CID 132569684) has the molecular formula C22H23NO2
and a molecular weight of 333.43 g/mol. Its IUPAC name is (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate.
Molecular Properties
| Compound Name | (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate |
| PubChem CID | 132569684 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate |
| SMILES | Cc1cc2c(C(C)C)ccc(C)c2cc1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H23NO2/c1-14(2)18-11-10-15(3)19-13-21(16(4)12-20(18)19)25-22(24)23-17-8-6-5-7-9-17/h5-14H,1-4H3,(H,23,24) |
| InChIKey | FXVKNXSTSPOTHX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate?
The IUPAC name of (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate (CID 132569684) is (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate.
What is the SMILES notation for (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate?
The canonical SMILES for (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate is Cc1cc2c(C(C)C)ccc(C)c2cc1OC(=O)Nc1ccccc1.
What is the InChIKey of (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate?
The InChIKey is FXVKNXSTSPOTHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO2/c1-14(2)18-11-10-15(3)19-13-21(16(4)12-20(18)19)25-22(24)23-17-8-6-5-7-9-17/h5-14H,1-4H3,(H,23,24).
What are the key properties of (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate?
(3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate has a molecular weight of 333.43 g/mol, XLogP of 6.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,8-dimethyl-5-propan-2-ylnaphthalen-2-yl) N-phenylcarbamate is sourced from PubChem (CID 132569684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).