C28H25O2P — CID 132569783
[(9S,10S)-9,10-dimethyl-8,11-dioxatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-yl]-diphenylphosphane (PubChem CID 132569783) has the molecular formula C28H25O2P and a molecular weight of 424.48 g/mol. Its IUPAC name is [(9S,10S)-9,10-dimethyl-8,11-dioxatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-yl]-diphenylphosphane.
| Compound Name | [(9S,10S)-9,10-dimethyl-8,11-dioxatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 132569783 |
| Molecular Formula | C28H25O2P |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [(9S,10S)-9,10-dimethyl-8,11-dioxatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-3-yl]-diphenylphosphane |
| SMILES | C[C@@H]1Oc2ccccc2-c2c(cccc2P(c2ccccc2)c2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C28H25O2P/c1-20-21(2)30-26-18-11-19-27(28(26)24-16-9-10-17-25(24)29-20)31(22-12-5-3-6-13-22)23-14-7-4-8-15-23/h3-21H,1-2H3/t20-,21-/m0/s1 |
| InChIKey | XRPTUDJTFVLTKQ-SFTDATJTSA-N |
| XLogP | 5.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|