C36H42B2N6O4 — CID 132569896
1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-[3-[1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]triazol-4-yl]phenyl]triazole (PubChem CID 132569896) has the molecular formula C36H42B2N6O4 and a molecular weight of 644.39 g/mol. Its IUPAC name is 1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-[3-[1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]triazol-4-yl]phenyl]triazole.
| Compound Name | 1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-[3-[1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]triazol-4-yl]phenyl]triazole |
|---|---|
| PubChem CID | 132569896 |
| Molecular Formula | C36H42B2N6O4 |
| Molecular Weight | 644.39 g/mol |
| Exact Mass | 644.35 |
| IUPAC Name | 1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-[3-[1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]triazol-4-yl]phenyl]triazole |
| SMILES | CC1(C)OB(c2ccccc2Cn2cc(-c3cccc(-c4cn(Cc5ccccc5B5OC(C)(C)C(C)(C)O5)nn4)c3)nn2)OC1(C)C |
| InChI | InChI=1S/C36H42B2N6O4/c1-33(2)34(3,4)46-37(45-33)29-18-11-9-14-27(29)21-43-23-31(39-41-43)25-16-13-17-26(20-25)32-24-44(42-40-32)22-28-15-10-12-19-30(28)38-47-35(5,6)36(7,8)48-38/h9-20,23-24H,21-22H2,1-8H3 |
| InChIKey | JQLKQTOTJCZGRK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|