About CID 132570649
CID 132570649 (PubChem CID 132570649) has the molecular formula C13H14NO
and a molecular weight of 200.26 g/mol.
Molecular Properties
| Compound Name | CID 132570649 |
| PubChem CID | 132570649 |
| Molecular Formula | C13H14NO |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | — |
| SMILES | CC1=Nc2ccccc2C12[CH]COCC2 |
| InChI | InChI=1S/C13H14NO/c1-10-13(6-8-15-9-7-13)11-4-2-3-5-12(11)14-10/h2-6H,7-9H2,1H3 |
| InChIKey | KMMVTUKIPPSCLL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 132570649 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 132570649?
The IUPAC name of CID 132570649 (CID 132570649) is not available.
What is the SMILES notation for CID 132570649?
The canonical SMILES for CID 132570649 is CC1=Nc2ccccc2C12[CH]COCC2.
What is the InChIKey of CID 132570649?
The InChIKey is KMMVTUKIPPSCLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14NO/c1-10-13(6-8-15-9-7-13)11-4-2-3-5-12(11)14-10/h2-6H,7-9H2,1H3.
What are the key properties of CID 132570649?
CID 132570649 has a molecular weight of 200.26 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 132570649 is sourced from PubChem (CID 132570649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).