About 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline
3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline (PubChem CID 132570727) has the molecular formula C27H24F3NO
and a molecular weight of 435.49 g/mol. Its IUPAC name is 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline.
Molecular Properties
| Compound Name | 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline |
| PubChem CID | 132570727 |
| Molecular Formula | C27H24F3NO |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline |
| SMILES | Cc1cc(C)cc(-c2cccc(C(F)(F)F)c2COCc2cc3ccccc3nc2C)c1 |
| InChI | InChI=1S/C27H24F3NO/c1-17-11-18(2)13-21(12-17)23-8-6-9-25(27(28,29)30)24(23)16-32-15-22-14-20-7-4-5-10-26(20)31-19(22)3/h4-14H,15-16H2,1-3H3 |
| InChIKey | RFLNTWSRJSCNOM-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline?
The IUPAC name of 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline (CID 132570727) is 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline.
What is the SMILES notation for 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline?
The canonical SMILES for 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline is Cc1cc(C)cc(-c2cccc(C(F)(F)F)c2COCc2cc3ccccc3nc2C)c1.
What is the InChIKey of 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline?
The InChIKey is RFLNTWSRJSCNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24F3NO/c1-17-11-18(2)13-21(12-17)23-8-6-9-25(27(28,29)30)24(23)16-32-15-22-14-20-7-4-5-10-26(20)31-19(22)3/h4-14H,15-16H2,1-3H3.
What are the key properties of 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline?
3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline has a molecular weight of 435.49 g/mol, XLogP of 7.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(3,5-dimethylphenyl)-6-(trifluoromethyl)phenyl]methoxymethyl]-2-methylquinoline is sourced from PubChem (CID 132570727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).