C19H29BF2O2 — CID 132571065
2-[2-(1-adamantyl)-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 132571065) has the molecular formula C19H29BF2O2 and a molecular weight of 338.25 g/mol. Its IUPAC name is 2-[2-(1-adamantyl)-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(1-adamantyl)-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 132571065 |
| Molecular Formula | C19H29BF2O2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2-[2-(1-adamantyl)-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(CC(=C(F)F)C23CC4CC(CC(C4)C2)C3)OC1(C)C |
| InChI | InChI=1S/C19H29BF2O2/c1-17(2)18(3,4)24-20(23-17)11-15(16(21)22)19-8-12-5-13(9-19)7-14(6-12)10-19/h12-14H,5-11H2,1-4H3 |
| InChIKey | TVQGBLNYWVHOGE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|