About (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide
(6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide (PubChem CID 132571084) has the molecular formula C9H6BBrF3O2-
and a molecular weight of 293.86 g/mol. Its IUPAC name is (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide.
Molecular Properties
| Compound Name | (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide |
| PubChem CID | 132571084 |
| Molecular Formula | C9H6BBrF3O2- |
| Molecular Weight | 293.86 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide |
| SMILES | O=C1CC([B-](F)(F)F)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C9H6BBrF3O2/c11-5-1-2-8-6(3-5)7(15)4-9(16-8)10(12,13)14/h1-3,9H,4H2/q-1 |
| InChIKey | FVFGDKYZDVUTBG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide?
The IUPAC name of (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide (CID 132571084) is (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide.
What is the SMILES notation for (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide?
The canonical SMILES for (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide is O=C1CC([B-](F)(F)F)Oc2ccc(Br)cc21.
What is the InChIKey of (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide?
The InChIKey is FVFGDKYZDVUTBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BBrF3O2/c11-5-1-2-8-6(3-5)7(15)4-9(16-8)10(12,13)14/h1-3,9H,4H2/q-1.
What are the key properties of (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide?
(6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide has a molecular weight of 293.86 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-4-oxo-2,3-dihydrochromen-2-yl)-trifluoroboranuide is sourced from PubChem (CID 132571084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).