C34H40N3O2P — CID 132571129
2,6-ditert-butyl-4-[(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)-pyridin-2-ylmethyl]phenol (PubChem CID 132571129) has the molecular formula C34H40N3O2P and a molecular weight of 553.69 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)-pyridin-2-ylmethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)-pyridin-2-ylmethyl]phenol |
|---|---|
| PubChem CID | 132571129 |
| Molecular Formula | C34H40N3O2P |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | 2,6-ditert-butyl-4-[(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)-pyridin-2-ylmethyl]phenol |
| SMILES | CC(C)(C)c1cc(C(c2ccccn2)P2(=O)N(c3ccccc3)CCN2c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C34H40N3O2P/c1-33(2,3)28-23-25(24-29(31(28)38)34(4,5)6)32(30-19-13-14-20-35-30)40(39)36(26-15-9-7-10-16-26)21-22-37(40)27-17-11-8-12-18-27/h7-20,23-24,32,38H,21-22H2,1-6H3 |
| InChIKey | QPFGBGJFXRHANA-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|