C14H22 — CID 132571572
3,3,8,8-tetramethyldeca-1,9-dien-5-yne (PubChem CID 132571572) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 3,3,8,8-tetramethyldeca-1,9-dien-5-yne.
| Compound Name | 3,3,8,8-tetramethyldeca-1,9-dien-5-yne |
|---|---|
| PubChem CID | 132571572 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 3,3,8,8-tetramethyldeca-1,9-dien-5-yne |
| SMILES | C=CC(C)(C)CC#CCC(C)(C)C=C |
| InChI | InChI=1S/C14H22/c1-7-13(3,4)11-9-10-12-14(5,6)8-2/h7-8H,1-2,11-12H2,3-6H3 |
| InChIKey | JDSFMXKIRGSWQQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|