C11H14O2 — CID 132571657
(2S,5R)-2-[(1E,3E)-hexa-1,3,5-trienyl]-5-methyloxolan-3-one (PubChem CID 132571657) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (2S,5R)-2-[(1E,3E)-hexa-1,3,5-trienyl]-5-methyloxolan-3-one.
| Compound Name | (2S,5R)-2-[(1E,3E)-hexa-1,3,5-trienyl]-5-methyloxolan-3-one |
|---|---|
| PubChem CID | 132571657 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2S,5R)-2-[(1E,3E)-hexa-1,3,5-trienyl]-5-methyloxolan-3-one |
| SMILES | C=C/C=C/C=C/[C@@H]1O[C@H](C)CC1=O |
| InChI | InChI=1S/C11H14O2/c1-3-4-5-6-7-11-10(12)8-9(2)13-11/h3-7,9,11H,1,8H2,2H3/b5-4+,7-6+/t9-,11+/m1/s1 |
| InChIKey | MBCSRDMQLSGMFC-BLKXLNBQSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|