C15H18Cl3NO2 — CID 132571992
(1S,4R,13S)-13-methyl-3-(2,2,2-trichloroacetyl)-3-azatricyclo[6.4.1.04,13]tridec-8-en-7-one (PubChem CID 132571992) has the molecular formula C15H18Cl3NO2 and a molecular weight of 350.67 g/mol. Its IUPAC name is (1S,4R,13S)-13-methyl-3-(2,2,2-trichloroacetyl)-3-azatricyclo[6.4.1.04,13]tridec-8-en-7-one.
| Compound Name | (1S,4R,13S)-13-methyl-3-(2,2,2-trichloroacetyl)-3-azatricyclo[6.4.1.04,13]tridec-8-en-7-one |
|---|---|
| PubChem CID | 132571992 |
| Molecular Formula | C15H18Cl3NO2 |
| Molecular Weight | 350.67 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | (1S,4R,13S)-13-methyl-3-(2,2,2-trichloroacetyl)-3-azatricyclo[6.4.1.04,13]tridec-8-en-7-one |
| SMILES | C[C@@]12C3=CCCC[C@@H]1CN(C(=O)C(Cl)(Cl)Cl)[C@@H]2CCC3=O |
| InChI | InChI=1S/C15H18Cl3NO2/c1-14-9-4-2-3-5-10(14)11(20)6-7-12(14)19(8-9)13(21)15(16,17)18/h5,9,12H,2-4,6-8H2,1H3/t9-,12-,14+/m1/s1 |
| InChIKey | GLTWSQWSPUYYNR-IUPBHXKESA-N |
| XLogP | 3.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|