C47H75NPSi2- — CID 132572520
N,N-dimethyl-2,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]-1-phosphanida-2,3-disilacyclopropan-2-amine (PubChem CID 132572520) has the molecular formula C47H75NPSi2- and a molecular weight of 741.27 g/mol. Its IUPAC name is N,N-dimethyl-2,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]-1-phosphanida-2,3-disilacyclopropan-2-amine.
| Compound Name | N,N-dimethyl-2,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]-1-phosphanida-2,3-disilacyclopropan-2-amine |
|---|---|
| PubChem CID | 132572520 |
| Molecular Formula | C47H75NPSi2- |
| Molecular Weight | 741.27 g/mol |
| Exact Mass | 740.52 |
| IUPAC Name | N,N-dimethyl-2,3,3-tris[2,4,6-tri(propan-2-yl)phenyl]-1-phosphanida-2,3-disilacyclopropan-2-amine |
| SMILES | CC(C)c1cc(C(C)C)c([Si]2(c3c(C(C)C)cc(C(C)C)cc3C(C)C)[P-][Si]2(c2c(C(C)C)cc(C(C)C)cc2C(C)C)N(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C47H75NPSi2/c1-27(2)36-21-39(30(7)8)45(40(22-36)31(9)10)50(46-41(32(11)12)23-37(28(3)4)24-42(46)33(13)14)49-51(50,48(19)20)47-43(34(15)16)25-38(29(5)6)26-44(47)35(17)18/h21-35H,1-20H3/q-1 |
| InChIKey | MWBHVVFNNPLRFY-UHFFFAOYSA-N |
| XLogP | 12.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.27 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|