C22H26N2 — CID 132572721
(1R,10S)-13,15,17-trimethyl-2,17-diazapentacyclo[8.7.4.01,10.03,8.011,16]henicosa-3,5,7,11,13,15-hexaene (PubChem CID 132572721) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,10S)-13,15,17-trimethyl-2,17-diazapentacyclo[8.7.4.01,10.03,8.011,16]henicosa-3,5,7,11,13,15-hexaene.
| Compound Name | (1R,10S)-13,15,17-trimethyl-2,17-diazapentacyclo[8.7.4.01,10.03,8.011,16]henicosa-3,5,7,11,13,15-hexaene |
|---|---|
| PubChem CID | 132572721 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (1R,10S)-13,15,17-trimethyl-2,17-diazapentacyclo[8.7.4.01,10.03,8.011,16]henicosa-3,5,7,11,13,15-hexaene |
| SMILES | Cc1cc(C)c2c(c1)[C@@]13CCCC[C@@]1(Nc1ccccc1C3)N2C |
| InChI | InChI=1S/C22H26N2/c1-15-12-16(2)20-18(13-15)21-10-6-7-11-22(21,24(20)3)23-19-9-5-4-8-17(19)14-21/h4-5,8-9,12-13,23H,6-7,10-11,14H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | DWVJVQQMJKBKPI-FCHUYYIVSA-N |
| XLogP | 4.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |