C39H33N5OS2 — CID 132572822
2-[[4-[4-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methylideneamino]-N-(4-methoxyphenyl)anilino]phenyl]iminomethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 132572822) has the molecular formula C39H33N5OS2 and a molecular weight of 651.86 g/mol. Its IUPAC name is 2-[[4-[4-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methylideneamino]-N-(4-methoxyphenyl)anilino]phenyl]iminomethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[[4-[4-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methylideneamino]-N-(4-methoxyphenyl)anilino]phenyl]iminomethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 132572822 |
| Molecular Formula | C39H33N5OS2 |
| Molecular Weight | 651.86 g/mol |
| Exact Mass | 651.21 |
| IUPAC Name | 2-[[4-[4-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methylideneamino]-N-(4-methoxyphenyl)anilino]phenyl]iminomethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | COc1ccc(N(c2ccc(/N=C/c3sc4c(c3C#N)CCCC4)cc2)c2ccc(/N=C/c3sc4c(c3C#N)CCCC4)cc2)cc1 |
| InChI | InChI=1S/C39H33N5OS2/c1-45-31-20-18-30(19-21-31)44(28-14-10-26(11-15-28)42-24-38-34(22-40)32-6-2-4-8-36(32)46-38)29-16-12-27(13-17-29)43-25-39-35(23-41)33-7-3-5-9-37(33)47-39/h10-21,24-25H,2-9H2,1H3/b42-24+,43-25+ |
| InChIKey | DYZKIMAEOBZOTN-FFVIWPAXSA-N |
| XLogP | 10.29 |
| TPSA | 84.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.86 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|