About (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate
(1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate (PubChem CID 132574158) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate.
Molecular Properties
| Compound Name | (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate |
| PubChem CID | 132574158 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate |
| SMILES | CCCN(CCC)C(=O)OC(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO3/c1-4-11-17(12-5-2)16(19)20-13(3)15(18)14-9-7-6-8-10-14/h6-10,13H,4-5,11-12H2,1-3H3 |
| InChIKey | QIINARHROYSJAZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate?
The IUPAC name of (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate (CID 132574158) is (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate.
What is the SMILES notation for (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate?
The canonical SMILES for (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate is CCCN(CCC)C(=O)OC(C)C(=O)c1ccccc1.
What is the InChIKey of (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate?
The InChIKey is QIINARHROYSJAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-4-11-17(12-5-2)16(19)20-13(3)15(18)14-9-7-6-8-10-14/h6-10,13H,4-5,11-12H2,1-3H3.
What are the key properties of (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate?
(1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate has a molecular weight of 277.36 g/mol, XLogP of 3.52, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-oxo-1-phenylpropan-2-yl) N,N-dipropylcarbamate is sourced from PubChem (CID 132574158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).