C15H29NOS — CID 132574207
N-[(1S)-1-(cyclohexen-1-yl)-3-methylbutyl]-2-methylpropane-2-sulfinamide (PubChem CID 132574207) has the molecular formula C15H29NOS and a molecular weight of 271.47 g/mol. Its IUPAC name is N-[(1S)-1-(cyclohexen-1-yl)-3-methylbutyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1S)-1-(cyclohexen-1-yl)-3-methylbutyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 132574207 |
| Molecular Formula | C15H29NOS |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N-[(1S)-1-(cyclohexen-1-yl)-3-methylbutyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)C[C@H](NS(=O)C(C)(C)C)C1=CCCCC1 |
| InChI | InChI=1S/C15H29NOS/c1-12(2)11-14(13-9-7-6-8-10-13)16-18(17)15(3,4)5/h9,12,14,16H,6-8,10-11H2,1-5H3/t14-,18?/m0/s1 |
| InChIKey | SKKJWYWOMHXKBH-PIVQAISJSA-N |
| XLogP | 3.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|