C20H13N5 — CID 132575209
3,7-diphenyl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene (PubChem CID 132575209) has the molecular formula C20H13N5 and a molecular weight of 323.36 g/mol. Its IUPAC name is 3,7-diphenyl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene.
| Compound Name | 3,7-diphenyl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 132575209 |
| Molecular Formula | C20H13N5 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3,7-diphenyl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene |
| SMILES | C1=CC2=NC(c3ccccc3)=NC3=NC(c4ccccc4)=NC(=C1)N23 |
| InChI | InChI=1S/C20H13N5/c1-3-8-14(9-4-1)18-21-16-12-7-13-17-22-19(15-10-5-2-6-11-15)24-20(23-18)25(16)17/h1-13H |
| InChIKey | UOLQHFNPBWKGQX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |