C19H14O9 — CID 132575229
(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-8-oxo-3,4-dihydro-2H-pyrano[2,3-f]chromene-10-carboxylic acid (PubChem CID 132575229) has the molecular formula C19H14O9 and a molecular weight of 386.31 g/mol. Its IUPAC name is (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-8-oxo-3,4-dihydro-2H-pyrano[2,3-f]chromene-10-carboxylic acid.
| Compound Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-8-oxo-3,4-dihydro-2H-pyrano[2,3-f]chromene-10-carboxylic acid |
|---|---|
| PubChem CID | 132575229 |
| Molecular Formula | C19H14O9 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-8-oxo-3,4-dihydro-2H-pyrano[2,3-f]chromene-10-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)oc2cc(O)c3c(c12)O[C@H](c1ccc(O)c(O)c1)[C@H](O)C3 |
| InChI | InChI=1S/C19H14O9/c20-10-2-1-7(3-12(10)22)17-13(23)4-8-11(21)6-14-16(18(8)28-17)9(19(25)26)5-15(24)27-14/h1-3,5-6,13,17,20-23H,4H2,(H,25,26)/t13-,17-/m1/s1 |
| InChIKey | JYTVYZPUNTVSAN-CXAGYDPISA-N |
| XLogP | 1.65 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|