About [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate
[4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate (PubChem CID 132575314) has the molecular formula C19H34O2
and a molecular weight of 294.48 g/mol. Its IUPAC name is [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate.
Molecular Properties
| Compound Name | [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate |
| PubChem CID | 132575314 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate |
| SMILES | CC(CC(C)(C)COC(=O)C1CC1)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C19H34O2/c1-14(16-7-6-10-18(2,3)12-16)11-19(4,5)13-21-17(20)15-8-9-15/h14-16H,6-13H2,1-5H3 |
| InChIKey | BGINDEZAWBGRQK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate?
The IUPAC name of [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate (CID 132575314) is [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate.
What is the SMILES notation for [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate?
The canonical SMILES for [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate is CC(CC(C)(C)COC(=O)C1CC1)C1CCCC(C)(C)C1.
What is the InChIKey of [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate?
The InChIKey is BGINDEZAWBGRQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O2/c1-14(16-7-6-10-18(2,3)12-16)11-19(4,5)13-21-17(20)15-8-9-15/h14-16H,6-13H2,1-5H3.
What are the key properties of [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate?
[4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate has a molecular weight of 294.48 g/mol, XLogP of 5.21, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,3-dimethylcyclohexyl)-2,2-dimethylpentyl] cyclopropanecarboxylate is sourced from PubChem (CID 132575314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).