C24H24BF10N — CID 132575350
bis(2,3,4,5,6-pentafluorophenyl)-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]borane (PubChem CID 132575350) has the molecular formula C24H24BF10N and a molecular weight of 527.26 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]borane.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]borane |
|---|---|
| PubChem CID | 132575350 |
| Molecular Formula | C24H24BF10N |
| Molecular Weight | 527.26 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-[3-(2,2,6,6-tetramethylpiperidin-1-yl)propyl]borane |
| SMILES | CC1(C)CCCC(C)(C)N1CCCB(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H24BF10N/c1-23(2)7-5-8-24(3,4)36(23)10-6-9-25(11-13(26)17(30)21(34)18(31)14(11)27)12-15(28)19(32)22(35)20(33)16(12)29/h5-10H2,1-4H3 |
| InChIKey | WVOWHFQSCCLMRJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.26 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|