C35H18F6S2 — CID 132575450
4,10-bis[4-(trifluoromethyl)phenyl]spiro[5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene-7,9'-fluorene] (PubChem CID 132575450) has the molecular formula C35H18F6S2 and a molecular weight of 616.65 g/mol. Its IUPAC name is 4,10-bis[4-(trifluoromethyl)phenyl]spiro[5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene-7,9'-fluorene].
| Compound Name | 4,10-bis[4-(trifluoromethyl)phenyl]spiro[5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene-7,9'-fluorene] |
|---|---|
| PubChem CID | 132575450 |
| Molecular Formula | C35H18F6S2 |
| Molecular Weight | 616.65 g/mol |
| Exact Mass | 616.08 |
| IUPAC Name | 4,10-bis[4-(trifluoromethyl)phenyl]spiro[5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene-7,9'-fluorene] |
| SMILES | FC(F)(F)c1ccc(-c2cc3c(s2)C2(c4ccccc4-c4ccccc42)c2sc(-c4ccc(C(F)(F)F)cc4)cc2-3)cc1 |
| InChI | InChI=1S/C35H18F6S2/c36-34(37,38)21-13-9-19(10-14-21)29-17-25-26-18-30(20-11-15-22(16-12-20)35(39,40)41)43-32(26)33(31(25)42-29)27-7-3-1-5-23(27)24-6-2-4-8-28(24)33/h1-18H |
| InChIKey | FDVXUTWWYAOJND-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.65 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |