About 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride
4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride (PubChem CID 13257546) has the molecular formula C9H11Cl2N3
and a molecular weight of 232.11 g/mol. Its IUPAC name is 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride |
| PubChem CID | 13257546 |
| Molecular Formula | C9H11Cl2N3 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride |
| SMILES | Cc1c2cnnc(Cl)c2c(C)n1C.Cl |
| InChI | InChI=1S/C9H10ClN3.ClH/c1-5-7-4-11-12-9(10)8(7)6(2)13(5)3;/h4H,1-3H3;1H |
| InChIKey | SSJAZRJBDZCETI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride?
The IUPAC name of 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride (CID 13257546) is 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride.
What is the SMILES notation for 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride?
The canonical SMILES for 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride is Cc1c2cnnc(Cl)c2c(C)n1C.Cl.
What is the InChIKey of 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride?
The InChIKey is SSJAZRJBDZCETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3.ClH/c1-5-7-4-11-12-9(10)8(7)6(2)13(5)3;/h4H,1-3H3;1H.
What are the key properties of 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride?
4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride has a molecular weight of 232.11 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5,6,7-trimethylpyrrolo[3,4-d]pyridazine;hydrochloride is sourced from PubChem (CID 13257546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).