C31H31NO5 — CID 132575584
diethyl (9S,9aS)-2-benzyl-3-oxo-9-phenyl-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate (PubChem CID 132575584) has the molecular formula C31H31NO5 and a molecular weight of 497.59 g/mol. Its IUPAC name is diethyl (9S,9aS)-2-benzyl-3-oxo-9-phenyl-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate.
| Compound Name | diethyl (9S,9aS)-2-benzyl-3-oxo-9-phenyl-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 132575584 |
| Molecular Formula | C31H31NO5 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | diethyl (9S,9aS)-2-benzyl-3-oxo-9-phenyl-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccccc2[C@H](c2ccccc2)[C@@H]2CN(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C31H31NO5/c1-3-36-29(34)31(30(35)37-4-2)25-18-12-11-17-23(25)26(22-15-9-6-10-16-22)24-20-32(28(33)27(24)31)19-21-13-7-5-8-14-21/h5-18,24,26-27H,3-4,19-20H2,1-2H3/t24-,26-,27?/m0/s1 |
| InChIKey | JXYCZRMZUXEKFB-OGUPFJCYSA-N |
| XLogP | 4.47 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|