C25H27NO5 — CID 132575585
diethyl (3aS,9aS)-2-benzyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate (PubChem CID 132575585) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is diethyl (3aS,9aS)-2-benzyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate.
| Compound Name | diethyl (3aS,9aS)-2-benzyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 132575585 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | diethyl (3aS,9aS)-2-benzyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccccc2C[C@@H]2CN(Cc3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C25H27NO5/c1-3-30-23(28)25(24(29)31-4-2)20-13-9-8-12-18(20)14-19-16-26(22(27)21(19)25)15-17-10-6-5-7-11-17/h5-13,19,21H,3-4,14-16H2,1-2H3/t19-,21-/m1/s1 |
| InChIKey | MDVAOGJJRNWRQZ-TZIWHRDSSA-N |
| XLogP | 2.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|