C17H28O3 — CID 132575866
methyl 2-[(3R,8aS)-3-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetate (PubChem CID 132575866) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is methyl 2-[(3R,8aS)-3-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetate.
| Compound Name | methyl 2-[(3R,8aS)-3-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 132575866 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | methyl 2-[(3R,8aS)-3-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetate |
| SMILES | COC(=O)CC1=C(C)[C@H](O)CC2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C17H28O3/c1-11-12(9-15(19)20-5)17(4)8-6-7-16(2,3)14(17)10-13(11)18/h13-14,18H,6-10H2,1-5H3/t13-,14?,17-/m1/s1 |
| InChIKey | IOFGSBQVWQBMEG-SNVMCYLTSA-N |
| XLogP | 3.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|