About quinolin-4-one
quinolin-4-one (PubChem CID 132576000) has the molecular formula C9H5NO
and a molecular weight of 143.14 g/mol. Its IUPAC name is quinolin-4-one.
Molecular Properties
| Compound Name | quinolin-4-one |
| PubChem CID | 132576000 |
| Molecular Formula | C9H5NO |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | quinolin-4-one |
| SMILES | O=C1C=CN=C2C=CC=C=C12 |
| InChI | InChI=1S/C9H5NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h1-2,4-6H |
| InChIKey | BSMHQDMYFUKCSO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-4-one?
The IUPAC name of quinolin-4-one (CID 132576000) is quinolin-4-one.
What is the SMILES notation for quinolin-4-one?
The canonical SMILES for quinolin-4-one is O=C1C=CN=C2C=CC=C=C12.
What is the InChIKey of quinolin-4-one?
The InChIKey is BSMHQDMYFUKCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h1-2,4-6H.
What are the key properties of quinolin-4-one?
quinolin-4-one has a molecular weight of 143.14 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-4-one is sourced from PubChem (CID 132576000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).