C34H46O5Si — CID 132576246
ethyl (1S,2R,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxan-5-yl)-6-ethenyl-2-methylcyclohex-3-ene-1-carboxylate (PubChem CID 132576246) has the molecular formula C34H46O5Si and a molecular weight of 562.82 g/mol. Its IUPAC name is ethyl (1S,2R,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxan-5-yl)-6-ethenyl-2-methylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,2R,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxan-5-yl)-6-ethenyl-2-methylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 132576246 |
| Molecular Formula | C34H46O5Si |
| Molecular Weight | 562.82 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | ethyl (1S,2R,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxan-5-yl)-6-ethenyl-2-methylcyclohex-3-ene-1-carboxylate |
| SMILES | C=C[C@@H]1[C@@H](C(=O)OCC)[C@H](C)C=C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1C1COC(C)(C)OC1 |
| InChI | InChI=1S/C34H46O5Si/c1-9-28-30(32(35)36-10-2)24(3)21-29(31(28)25-22-37-34(7,8)38-23-25)39-40(33(4,5)6,26-17-13-11-14-18-26)27-19-15-12-16-20-27/h9,11-21,24-25,28,30-31H,1,10,22-23H2,2-8H3/t24-,28-,30+,31-/m1/s1 |
| InChIKey | YIWHYAZCQKVZPH-KCHDQCRPSA-N |
| XLogP | 6.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.82 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|