C21H24N2O4 — CID 132576286
(1R,4S,15R,16S,19R,20S,21S)-8,10-dioxa-5,17-diazaoctacyclo[15.5.3.01,16.04,15.04,21.06,14.07,11.015,19]pentacosa-6(14),7(11),12-triene-20,21-diol (PubChem CID 132576286) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (1R,4S,15R,16S,19R,20S,21S)-8,10-dioxa-5,17-diazaoctacyclo[15.5.3.01,16.04,15.04,21.06,14.07,11.015,19]pentacosa-6(14),7(11),12-triene-20,21-diol.
| Compound Name | (1R,4S,15R,16S,19R,20S,21S)-8,10-dioxa-5,17-diazaoctacyclo[15.5.3.01,16.04,15.04,21.06,14.07,11.015,19]pentacosa-6(14),7(11),12-triene-20,21-diol |
|---|---|
| PubChem CID | 132576286 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (1R,4S,15R,16S,19R,20S,21S)-8,10-dioxa-5,17-diazaoctacyclo[15.5.3.01,16.04,15.04,21.06,14.07,11.015,19]pentacosa-6(14),7(11),12-triene-20,21-diol |
| SMILES | O[C@H]1[C@H]2CN3CCC[C@]45CC[C@@]6(Nc7c(ccc8c7OCO8)[C@@]26[C@@H]34)[C@@]1(O)C5 |
| InChI | InChI=1S/C21H24N2O4/c24-16-12-8-23-7-1-4-18-5-6-20(19(16,25)9-18)21(12,17(18)23)11-2-3-13-15(14(11)22-20)27-10-26-13/h2-3,12,16-17,22,24-25H,1,4-10H2/t12-,16+,17+,18-,19-,20-,21+/m1/s1 |
| InChIKey | KQPLGQYNNOTALI-AGDNNBLOSA-N |
| XLogP | 1.20 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |