C25H38O3 — CID 132576373
(1'R,2S,4S,5'S)-6,6,8,8-tetramethyl-4-(2-methylpropyl)-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-bicyclo[3.1.0]hexane]-5,7-dione (PubChem CID 132576373) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (1'R,2S,4S,5'S)-6,6,8,8-tetramethyl-4-(2-methylpropyl)-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-bicyclo[3.1.0]hexane]-5,7-dione.
| Compound Name | (1'R,2S,4S,5'S)-6,6,8,8-tetramethyl-4-(2-methylpropyl)-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-bicyclo[3.1.0]hexane]-5,7-dione |
|---|---|
| PubChem CID | 132576373 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (1'R,2S,4S,5'S)-6,6,8,8-tetramethyl-4-(2-methylpropyl)-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-bicyclo[3.1.0]hexane]-5,7-dione |
| SMILES | CC(C)C[C@H]1C[C@]2(CC[C@]3(C(C)C)C[C@H]23)OC2=C1C(=O)C(C)(C)C(=O)C2(C)C |
| InChI | InChI=1S/C25H38O3/c1-14(2)11-16-12-25(10-9-24(15(3)4)13-17(24)25)28-20-18(16)19(26)22(5,6)21(27)23(20,7)8/h14-17H,9-13H2,1-8H3/t16-,17-,24+,25-/m0/s1 |
| InChIKey | AWVVHJNYLKQUAI-SBWJZRSDSA-N |
| XLogP | 5.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|