C25H38O3 — CID 132576374
(2R,4R)-2-ethenyl-6,6,8,8-tetramethyl-2-(4-methylpent-3-enyl)-4-(2-methylpropyl)-3,4-dihydrochromene-5,7-dione (PubChem CID 132576374) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (2R,4R)-2-ethenyl-6,6,8,8-tetramethyl-2-(4-methylpent-3-enyl)-4-(2-methylpropyl)-3,4-dihydrochromene-5,7-dione.
| Compound Name | (2R,4R)-2-ethenyl-6,6,8,8-tetramethyl-2-(4-methylpent-3-enyl)-4-(2-methylpropyl)-3,4-dihydrochromene-5,7-dione |
|---|---|
| PubChem CID | 132576374 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (2R,4R)-2-ethenyl-6,6,8,8-tetramethyl-2-(4-methylpent-3-enyl)-4-(2-methylpropyl)-3,4-dihydrochromene-5,7-dione |
| SMILES | C=C[C@@]1(CCC=C(C)C)C[C@@H](CC(C)C)C2=C(O1)C(C)(C)C(=O)C(C)(C)C2=O |
| InChI | InChI=1S/C25H38O3/c1-10-25(13-11-12-16(2)3)15-18(14-17(4)5)19-20(26)23(6,7)22(27)24(8,9)21(19)28-25/h10,12,17-18H,1,11,13-15H2,2-9H3/t18-,25-/m1/s1 |
| InChIKey | HSUQGAGUNSIVOE-IQGLISFBSA-N |
| XLogP | 6.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|