C32H31NOSi — CID 132576551
4-[(E,1S,2R)-2-methyl-4-[methyl(diphenyl)silyl]-1-phenylmethoxybut-3-enyl]benzonitrile (PubChem CID 132576551) has the molecular formula C32H31NOSi and a molecular weight of 473.69 g/mol. Its IUPAC name is 4-[(E,1S,2R)-2-methyl-4-[methyl(diphenyl)silyl]-1-phenylmethoxybut-3-enyl]benzonitrile.
| Compound Name | 4-[(E,1S,2R)-2-methyl-4-[methyl(diphenyl)silyl]-1-phenylmethoxybut-3-enyl]benzonitrile |
|---|---|
| PubChem CID | 132576551 |
| Molecular Formula | C32H31NOSi |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 4-[(E,1S,2R)-2-methyl-4-[methyl(diphenyl)silyl]-1-phenylmethoxybut-3-enyl]benzonitrile |
| SMILES | C[C@H](/C=C/[Si](C)(c1ccccc1)c1ccccc1)[C@H](OCc1ccccc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C32H31NOSi/c1-26(22-23-35(2,30-14-8-4-9-15-30)31-16-10-5-11-17-31)32(29-20-18-27(24-33)19-21-29)34-25-28-12-6-3-7-13-28/h3-23,26,32H,25H2,1-2H3/b23-22+/t26-,32+/m1/s1 |
| InChIKey | JHKGIOLVSLYSKQ-ZLBUZLOGSA-N |
| XLogP | 6.44 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|