C12H18O5 — CID 132576834
(3R,4S,5R,6S)-4,5,6-trihydroxy-3-propyl-1,3,4,5,6,7-hexahydroisochromen-8-one (PubChem CID 132576834) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (3R,4S,5R,6S)-4,5,6-trihydroxy-3-propyl-1,3,4,5,6,7-hexahydroisochromen-8-one.
| Compound Name | (3R,4S,5R,6S)-4,5,6-trihydroxy-3-propyl-1,3,4,5,6,7-hexahydroisochromen-8-one |
|---|---|
| PubChem CID | 132576834 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (3R,4S,5R,6S)-4,5,6-trihydroxy-3-propyl-1,3,4,5,6,7-hexahydroisochromen-8-one |
| SMILES | CCC[C@H]1OCC2=C([C@@H](O)[C@@H](O)CC2=O)[C@@H]1O |
| InChI | InChI=1S/C12H18O5/c1-2-3-9-12(16)10-6(5-17-9)7(13)4-8(14)11(10)15/h8-9,11-12,14-16H,2-5H2,1H3/t8-,9+,11-,12+/m0/s1 |
| InChIKey | PQSAQAWQBGVJOF-BSJXLVFVSA-N |
| XLogP | -0.46 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |