C20H32O4 — CID 132576881
(3R,5E,7S,9R,13R,14R)-14-ethyl-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-5-ene-2,4,10-trione (PubChem CID 132576881) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (3R,5E,7S,9R,13R,14R)-14-ethyl-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-5-ene-2,4,10-trione.
| Compound Name | (3R,5E,7S,9R,13R,14R)-14-ethyl-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-5-ene-2,4,10-trione |
|---|---|
| PubChem CID | 132576881 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (3R,5E,7S,9R,13R,14R)-14-ethyl-3,5,7,9,13-pentamethyl-1-oxacyclotetradec-5-ene-2,4,10-trione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)/C(C)=C/[C@@H](C)C[C@@H](C)C(=O)CC[C@H]1C |
| InChI | InChI=1S/C20H32O4/c1-7-18-13(3)8-9-17(21)14(4)10-12(2)11-15(5)19(22)16(6)20(23)24-18/h11-14,16,18H,7-10H2,1-6H3/b15-11+/t12-,13+,14+,16+,18+/m0/s1 |
| InChIKey | ODJJRJLSIKJGKE-UJCQATBJSA-N |
| XLogP | 4.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|