C19H26O5 — CID 132577454
1-[3,5-dihydroxy-7-methoxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-3,4-dihydrochromen-6-yl]ethanone (PubChem CID 132577454) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is 1-[3,5-dihydroxy-7-methoxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-3,4-dihydrochromen-6-yl]ethanone.
| Compound Name | 1-[3,5-dihydroxy-7-methoxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-3,4-dihydrochromen-6-yl]ethanone |
|---|---|
| PubChem CID | 132577454 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-[3,5-dihydroxy-7-methoxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-3,4-dihydrochromen-6-yl]ethanone |
| SMILES | COc1c(CC=C(C)C)c2c(c(O)c1C(C)=O)CC(O)C(C)(C)O2 |
| InChI | InChI=1S/C19H26O5/c1-10(2)7-8-12-17-13(9-14(21)19(4,5)24-17)16(22)15(11(3)20)18(12)23-6/h7,14,21-22H,8-9H2,1-6H3 |
| InChIKey | YYILJYJMZWIEQM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|